C25H28F5N3O2 — CID 138968165
3-(2,3,4,5,6-pentafluorophenyl)-1-phenyl-4-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]imidazolidin-2-one (PubChem CID 138968165) has the molecular formula C25H28F5N3O2 and a molecular weight of 497.51 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenyl)-1-phenyl-4-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]imidazolidin-2-one.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenyl)-1-phenyl-4-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 138968165 |
| Molecular Formula | C25H28F5N3O2 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenyl)-1-phenyl-4-[(2,2,6,6-tetramethylpiperidin-1-yl)oxymethyl]imidazolidin-2-one |
| SMILES | CC1(C)CCCC(C)(C)N1OCC1CN(c2ccccc2)C(=O)N1c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H28F5N3O2/c1-24(2)11-8-12-25(3,4)33(24)35-14-16-13-31(15-9-6-5-7-10-15)23(34)32(16)22-20(29)18(27)17(26)19(28)21(22)30/h5-7,9-10,16H,8,11-14H2,1-4H3 |
| InChIKey | FQDYZGRXJOCKOD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|