C11H12NO2+ — CID 138968623
(3aR)-1a-methyl-3-methylidene-3a,4-dihydro-1H-cyclopropa[c]indol-3-ium-2,5-dione (PubChem CID 138968623) has the molecular formula C11H12NO2+ and a molecular weight of 190.22 g/mol. Its IUPAC name is (3aR)-1a-methyl-3-methylidene-3a,4-dihydro-1H-cyclopropa[c]indol-3-ium-2,5-dione.
| Compound Name | (3aR)-1a-methyl-3-methylidene-3a,4-dihydro-1H-cyclopropa[c]indol-3-ium-2,5-dione |
|---|---|
| PubChem CID | 138968623 |
| Molecular Formula | C11H12NO2+ |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | (3aR)-1a-methyl-3-methylidene-3a,4-dihydro-1H-cyclopropa[c]indol-3-ium-2,5-dione |
| SMILES | C=[N+]1C(=O)C2(C)CC23C=CC(=O)C[C@@H]13 |
| InChI | InChI=1S/C11H12NO2/c1-10-6-11(10)4-3-7(13)5-8(11)12(2)9(10)14/h3-4,8H,2,5-6H2,1H3/q+1/t8-,10?,11?/m1/s1 |
| InChIKey | GKPBAEFAZGGURR-MFAVDMRSSA-N |
| XLogP | 0.53 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|