C19H23NO2 — CID 146161979
(2S,6S,12S)-2,12-dimethyl-10-prop-2-enoyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadeca-9,11(15)-dien-5-one (PubChem CID 146161979) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2S,6S,12S)-2,12-dimethyl-10-prop-2-enoyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadeca-9,11(15)-dien-5-one.
| Compound Name | (2S,6S,12S)-2,12-dimethyl-10-prop-2-enoyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadeca-9,11(15)-dien-5-one |
|---|---|
| PubChem CID | 146161979 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2S,6S,12S)-2,12-dimethyl-10-prop-2-enoyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadeca-9,11(15)-dien-5-one |
| SMILES | C=CC(=O)C1=CCC[C@@H]2C(=O)N3C[C@@H](C)C4C=C1[C@@]2(C)C3C4 |
| InChI | InChI=1S/C19H23NO2/c1-4-16(21)13-6-5-7-14-18(22)20-10-11(2)12-8-15(13)19(14,3)17(20)9-12/h4,6,8,11-12,14,17H,1,5,7,9-10H2,2-3H3/t11-,12?,14-,17?,19+/m1/s1 |
| InChIKey | FHERGLVOCQNBAZ-VZNYHLAPSA-N |
| XLogP | 2.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|