C16H19NO3 — CID 134961781
(2S,6S,12S)-2,12-dimethyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-10-ene-5,9,15-trione (PubChem CID 134961781) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (2S,6S,12S)-2,12-dimethyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-10-ene-5,9,15-trione.
| Compound Name | (2S,6S,12S)-2,12-dimethyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-10-ene-5,9,15-trione |
|---|---|
| PubChem CID | 134961781 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (2S,6S,12S)-2,12-dimethyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-10-ene-5,9,15-trione |
| SMILES | C[C@@H]1CN2C(=O)[C@H]3CCC(=O)C=C4C(=O)C1CC2[C@]43C |
| InChI | InChI=1S/C16H19NO3/c1-8-7-17-13-6-10(8)14(19)12-5-9(18)3-4-11(15(17)20)16(12,13)2/h5,8,10-11,13H,3-4,6-7H2,1-2H3/t8-,10?,11-,13?,16+/m1/s1 |
| InChIKey | CRYZDQBSIVHNTH-SMMGGSSGSA-N |
| XLogP | 1.35 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |