C16H23NO — CID 102289134
(1R,2R,11S,12R,13R)-2,12-dimethyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-6-en-10-one (PubChem CID 102289134) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (1R,2R,11S,12R,13R)-2,12-dimethyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-6-en-10-one.
| Compound Name | (1R,2R,11S,12R,13R)-2,12-dimethyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-6-en-10-one |
|---|---|
| PubChem CID | 102289134 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (1R,2R,11S,12R,13R)-2,12-dimethyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-6-en-10-one |
| SMILES | C[C@H]1CN2CC3=CCCC(=O)[C@H]4C[C@@H]1C[C@@H]2[C@@]34C |
| InChI | InChI=1S/C16H23NO/c1-10-8-17-9-12-4-3-5-14(18)13-6-11(10)7-15(17)16(12,13)2/h4,10-11,13,15H,3,5-9H2,1-2H3/t10-,11+,13+,15+,16-/m0/s1 |
| InChIKey | GROZRFRAGSMSAX-NAGUFLCVSA-N |
| XLogP | 2.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|