C19H25NO2 — CID 134959947
(2S,6S,11R,12S)-2,12-dimethyl-11-prop-2-enyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-9-ene-5,15-dione (PubChem CID 134959947) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is (2S,6S,11R,12S)-2,12-dimethyl-11-prop-2-enyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-9-ene-5,15-dione.
| Compound Name | (2S,6S,11R,12S)-2,12-dimethyl-11-prop-2-enyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-9-ene-5,15-dione |
|---|---|
| PubChem CID | 134959947 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | (2S,6S,11R,12S)-2,12-dimethyl-11-prop-2-enyl-4-azatetracyclo[9.3.1.04,13.06,12]pentadec-9-ene-5,15-dione |
| SMILES | C=CC[C@@]12C=CCC[C@@H]3C(=O)N4C[C@@H](C)C(CC4[C@@]31C)C2=O |
| InChI | InChI=1S/C19H25NO2/c1-4-8-19-9-6-5-7-14-17(22)20-11-12(2)13(16(19)21)10-15(20)18(14,19)3/h4,6,9,12-15H,1,5,7-8,10-11H2,2-3H3/t12-,13?,14-,15?,18-,19+/m1/s1 |
| InChIKey | QXCWISSWUCCTIT-DBJGISLGSA-N |
| XLogP | 2.97 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|