C21H25NO3 — CID 166445438
(1R,2S,6S,10S,13R)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-16(19)-ene-9,15,20-trione (PubChem CID 166445438) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (1R,2S,6S,10S,13R)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-16(19)-ene-9,15,20-trione.
| Compound Name | (1R,2S,6S,10S,13R)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-16(19)-ene-9,15,20-trione |
|---|---|
| PubChem CID | 166445438 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (1R,2S,6S,10S,13R)-2,6-dimethyl-8-azahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icos-16(19)-ene-9,15,20-trione |
| SMILES | C[C@@H]1CN2C(=O)[C@H]3CC[C@@H]4CC(=O)C5=C4[C@@]4(CC5)C(=O)C1CC2[C@@]34C |
| InChI | InChI=1S/C21H25NO3/c1-10-9-22-16-8-13(10)18(24)21-6-5-12-15(23)7-11(17(12)21)3-4-14(19(22)25)20(16,21)2/h10-11,13-14,16H,3-9H2,1-2H3/t10-,11-,13?,14-,16?,20-,21+/m1/s1 |
| InChIKey | OYCNSUITUXTROE-NMXOGPKUSA-N |
| XLogP | 2.52 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |