C19H27NO — CID 162417273
(6R,9S,13S,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-en-10-one (PubChem CID 162417273) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (6R,9S,13S,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-en-10-one.
| Compound Name | (6R,9S,13S,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-en-10-one |
|---|---|
| PubChem CID | 162417273 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (6R,9S,13S,17S)-13,17-dimethyl-11-azapentacyclo[12.3.1.02,6.09,17.011,16]octadec-1-en-10-one |
| SMILES | C[C@@H]1CN2C(=O)[C@H]3CC[C@H]4CCCC4=C4CC1CC2[C@]43C |
| InChI | InChI=1S/C19H27NO/c1-11-10-20-17-9-13(11)8-16-14-5-3-4-12(14)6-7-15(18(20)21)19(16,17)2/h11-13,15,17H,3-10H2,1-2H3/t11-,12-,13?,15-,17?,19+/m1/s1 |
| InChIKey | CHWUEOSCVDOYAU-IKKVAWTJSA-N |
| XLogP | 3.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|