C19H35IO3Si — CID 138969157
2-[(2R,4E,6S)-4-(iodomethylidene)-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]acetaldehyde (PubChem CID 138969157) has the molecular formula C19H35IO3Si and a molecular weight of 466.48 g/mol. Its IUPAC name is 2-[(2R,4E,6S)-4-(iodomethylidene)-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,4E,6S)-4-(iodomethylidene)-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 138969157 |
| Molecular Formula | C19H35IO3Si |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[(2R,4E,6S)-4-(iodomethylidene)-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]acetaldehyde |
| SMILES | CC(C)[Si](OCC[C@@H]1C/C(=C\I)C[C@H](CC=O)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H35IO3Si/c1-14(2)24(15(3)4,16(5)6)22-10-8-19-12-17(13-20)11-18(23-19)7-9-21/h9,13-16,18-19H,7-8,10-12H2,1-6H3/b17-13-/t18-,19+/m0/s1 |
| InChIKey | AJSDCRCFOMYJCD-RCJGQPJSSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|