C19H36O2Si — CID 11573385
1-[(2S,4E,6S)-6-ethyl-4-(trimethylsilylmethylidene)oxan-2-yl]octan-2-one (PubChem CID 11573385) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is 1-[(2S,4E,6S)-6-ethyl-4-(trimethylsilylmethylidene)oxan-2-yl]octan-2-one.
| Compound Name | 1-[(2S,4E,6S)-6-ethyl-4-(trimethylsilylmethylidene)oxan-2-yl]octan-2-one |
|---|---|
| PubChem CID | 11573385 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 1-[(2S,4E,6S)-6-ethyl-4-(trimethylsilylmethylidene)oxan-2-yl]octan-2-one |
| SMILES | CCCCCCC(=O)C[C@@H]1C/C(=C/[Si](C)(C)C)C[C@H](CC)O1 |
| InChI | InChI=1S/C19H36O2Si/c1-6-8-9-10-11-17(20)14-19-13-16(15-22(3,4)5)12-18(7-2)21-19/h15,18-19H,6-14H2,1-5H3/b16-15+/t18-,19-/m0/s1 |
| InChIKey | KLWLHAJKZUNJHY-FLFATNBMSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|