C18H36O3Si — CID 11151611
(4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-8-methylidenedecan-2-one (PubChem CID 11151611) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-8-methylidenedecan-2-one.
| Compound Name | (4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-8-methylidenedecan-2-one |
|---|---|
| PubChem CID | 11151611 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-8-methylidenedecan-2-one |
| SMILES | C=C(CC)C[C@H](C[C@@H](CC(C)=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-10-14(2)11-17(13-16(20-7)12-15(3)19)21-22(8,9)18(4,5)6/h16-17H,2,10-13H2,1,3-9H3/t16-,17-/m1/s1 |
| InChIKey | OVDWXIDYVJIMLT-IAGOWNOFSA-N |
| XLogP | 5.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|