C17H34O2Si — CID 134942392
(10R)-10-hydroxy-12-(trimethylsilylmethyl)tridec-12-en-6-one (PubChem CID 134942392) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (10R)-10-hydroxy-12-(trimethylsilylmethyl)tridec-12-en-6-one.
| Compound Name | (10R)-10-hydroxy-12-(trimethylsilylmethyl)tridec-12-en-6-one |
|---|---|
| PubChem CID | 134942392 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (10R)-10-hydroxy-12-(trimethylsilylmethyl)tridec-12-en-6-one |
| SMILES | C=C(C[C@H](O)CCCC(=O)CCCCC)C[Si](C)(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-6-7-8-10-16(18)11-9-12-17(19)13-15(2)14-20(3,4)5/h17,19H,2,6-14H2,1,3-5H3/t17-/m1/s1 |
| InChIKey | NUVVTEKIRAPHMR-QGZVFWFLSA-N |
| XLogP | 4.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|