C15H30O2Si — CID 11482622
(E,9S)-9-hydroxy-12-trimethylsilyldodec-11-en-5-one (PubChem CID 11482622) has the molecular formula C15H30O2Si and a molecular weight of 270.49 g/mol. Its IUPAC name is (E,9S)-9-hydroxy-12-trimethylsilyldodec-11-en-5-one.
| Compound Name | (E,9S)-9-hydroxy-12-trimethylsilyldodec-11-en-5-one |
|---|---|
| PubChem CID | 11482622 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (E,9S)-9-hydroxy-12-trimethylsilyldodec-11-en-5-one |
| SMILES | CCCCC(=O)CCC[C@H](O)C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C15H30O2Si/c1-5-6-9-14(16)10-7-11-15(17)12-8-13-18(2,3)4/h8,13,15,17H,5-7,9-12H2,1-4H3/b13-8+/t15-/m0/s1 |
| InChIKey | XEMRPKAJWZDIFA-NRUITVPNSA-N |
| XLogP | 4.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|