C10H16O3 — CID 91387103
8-hydroxydec-9-ene-3,4-dione (PubChem CID 91387103) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 8-hydroxydec-9-ene-3,4-dione.
| Compound Name | 8-hydroxydec-9-ene-3,4-dione |
|---|---|
| PubChem CID | 91387103 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 8-hydroxydec-9-ene-3,4-dione |
| SMILES | C=CC(O)CCCC(=O)C(=O)CC |
| InChI | InChI=1S/C10H16O3/c1-3-8(11)6-5-7-10(13)9(12)4-2/h3,8,11H,1,4-7H2,2H3 |
| InChIKey | LVJBOWBFUSBOBX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|