C15H22O2 — CID 162851888
(8R,9E,13Z)-8-hydroxypentadeca-9,13-dien-11-yn-2-one (PubChem CID 162851888) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (8R,9E,13Z)-8-hydroxypentadeca-9,13-dien-11-yn-2-one.
| Compound Name | (8R,9E,13Z)-8-hydroxypentadeca-9,13-dien-11-yn-2-one |
|---|---|
| PubChem CID | 162851888 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (8R,9E,13Z)-8-hydroxypentadeca-9,13-dien-11-yn-2-one |
| SMILES | C/C=C\C#C/C=C/[C@H](O)CCCCCC(C)=O |
| InChI | InChI=1S/C15H22O2/c1-3-4-5-6-9-12-15(17)13-10-7-8-11-14(2)16/h3-4,9,12,15,17H,7-8,10-11,13H2,1-2H3/b4-3-,12-9+/t15-/m0/s1 |
| InChIKey | LIDVFDPYWJJTLV-OEFMQNLYSA-N |
| XLogP | 3.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|