C34H64O5Si2 — CID 138969500
methyl (2E,4E,6R,7S,8S,10E,12E,14S,15S,16S)-7-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-2,4,6,8,10,14,16-heptamethyl-15-trimethylsilyloxyheptadeca-2,4,10,12-tetraenoate (PubChem CID 138969500) has the molecular formula C34H64O5Si2 and a molecular weight of 609.05 g/mol. Its IUPAC name is methyl (2E,4E,6R,7S,8S,10E,12E,14S,15S,16S)-7-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-2,4,6,8,10,14,16-heptamethyl-15-trimethylsilyloxyheptadeca-2,4,10,12-tetraenoate.
| Compound Name | methyl (2E,4E,6R,7S,8S,10E,12E,14S,15S,16S)-7-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-2,4,6,8,10,14,16-heptamethyl-15-trimethylsilyloxyheptadeca-2,4,10,12-tetraenoate |
|---|---|
| PubChem CID | 138969500 |
| Molecular Formula | C34H64O5Si2 |
| Molecular Weight | 609.05 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | methyl (2E,4E,6R,7S,8S,10E,12E,14S,15S,16S)-7-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-2,4,6,8,10,14,16-heptamethyl-15-trimethylsilyloxyheptadeca-2,4,10,12-tetraenoate |
| SMILES | COC(=O)/C(C)=C/C(C)=C/[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C(C)=C/C=C/[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C34H64O5Si2/c1-24(18-17-19-26(3)31(30(7)23-35)38-40(12,13)14)20-27(4)32(39-41(15,16)34(8,9)10)28(5)21-25(2)22-29(6)33(36)37-11/h17-19,21-22,26-28,30-32,35H,20,23H2,1-16H3/b19-17+,24-18+,25-21+,29-22+/t26-,27-,28+,30-,31-,32-/m0/s1 |
| InChIKey | OWOIHFUTQMYRCK-ZESHAYOJSA-N |
| XLogP | 9.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.05 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|