C16H25NO — CID 138970199
(4aR)-2-(1-methylcyclohexyl)-1-oxido-4a,5,6,7,8,8a-hexahydroquinolin-1-ium (PubChem CID 138970199) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (4aR)-2-(1-methylcyclohexyl)-1-oxido-4a,5,6,7,8,8a-hexahydroquinolin-1-ium.
| Compound Name | (4aR)-2-(1-methylcyclohexyl)-1-oxido-4a,5,6,7,8,8a-hexahydroquinolin-1-ium |
|---|---|
| PubChem CID | 138970199 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (4aR)-2-(1-methylcyclohexyl)-1-oxido-4a,5,6,7,8,8a-hexahydroquinolin-1-ium |
| SMILES | CC1(C2=[N+]([O-])C3CCCC[C@@H]3C=C2)CCCCC1 |
| InChI | InChI=1S/C16H25NO/c1-16(11-5-2-6-12-16)15-10-9-13-7-3-4-8-14(13)17(15)18/h9-10,13-14H,2-8,11-12H2,1H3/t13-,14?/m1/s1 |
| InChIKey | HLBICFAYLQNXGV-KWCCSABGSA-N |
| XLogP | 4.04 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|