C19H31NO — CID 44517907
(E)-N-cyclohexyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine oxide (PubChem CID 44517907) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is (E)-N-cyclohexyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine oxide.
| Compound Name | (E)-N-cyclohexyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine oxide |
|---|---|
| PubChem CID | 44517907 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | (E)-N-cyclohexyl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine oxide |
| SMILES | CC1=C(/C=C/C(C)=[N+](/[O-])C2CCCCC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H31NO/c1-15-9-8-14-19(3,4)18(15)13-12-16(2)20(21)17-10-6-5-7-11-17/h12-13,17H,5-11,14H2,1-4H3/b13-12+,20-16+ |
| InChIKey | NXSOBTCOPVMSDK-QHRGAKLKSA-N |
| XLogP | 5.37 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|