C16H27NO — CID 170783250
(E)-N-propan-2-yl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine oxide (PubChem CID 170783250) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (E)-N-propan-2-yl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine oxide.
| Compound Name | (E)-N-propan-2-yl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine oxide |
|---|---|
| PubChem CID | 170783250 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (E)-N-propan-2-yl-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-imine oxide |
| SMILES | CC1=C(/C=C/C(C)=[N+](/[O-])C(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C16H27NO/c1-12(2)17(18)14(4)9-10-15-13(3)8-7-11-16(15,5)6/h9-10,12H,7-8,11H2,1-6H3/b10-9+,17-14+ |
| InChIKey | RKEMUHLXKZGNJZ-XYJQQDCNSA-N |
| XLogP | 4.45 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|