About (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one
(2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one (PubChem CID 138970627) has the molecular formula C15H26Br2O2Si
and a molecular weight of 426.27 g/mol. Its IUPAC name is (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one |
| PubChem CID | 138970627 |
| Molecular Formula | C15H26Br2O2Si |
| Molecular Weight | 426.27 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C=C(Br)Br)[C@H]1CCCCC1=O |
| InChI | InChI=1S/C15H26Br2O2Si/c1-15(2,3)20(4,5)19-13(10-14(16)17)11-8-6-7-9-12(11)18/h10-11,13H,6-9H2,1-5H3/t11-,13-/m0/s1 |
| InChIKey | DKASWWUIGRQIHO-AAEUAGOBSA-N |
| XLogP | 5.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.27 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one?
The IUPAC name of (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one (CID 138970627) is (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one.
What is the SMILES notation for (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one?
The canonical SMILES for (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one is CC(C)(C)[Si](C)(C)O[C@@H](C=C(Br)Br)[C@H]1CCCCC1=O.
What is the InChIKey of (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one?
The InChIKey is DKASWWUIGRQIHO-AAEUAGOBSA-N. The full InChI is InChI=1S/C15H26Br2O2Si/c1-15(2,3)20(4,5)19-13(10-14(16)17)11-8-6-7-9-12(11)18/h10-11,13H,6-9H2,1-5H3/t11-,13-/m0/s1.
What are the key properties of (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one?
(2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one has a molecular weight of 426.27 g/mol, XLogP of 5.77, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1R)-3,3-dibromo-1-[tert-butyl(dimethyl)silyl]oxyprop-2-enyl]cyclohexan-1-one is sourced from PubChem (CID 138970627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).