C21H40Br2O2Si — CID 11156519
(3R,5S,6R,7S)-1,1-dibromo-3,5,7-trimethyl-6-tri(propan-2-yl)silyloxynon-1-en-4-one (PubChem CID 11156519) has the molecular formula C21H40Br2O2Si and a molecular weight of 512.44 g/mol. Its IUPAC name is (3R,5S,6R,7S)-1,1-dibromo-3,5,7-trimethyl-6-tri(propan-2-yl)silyloxynon-1-en-4-one.
| Compound Name | (3R,5S,6R,7S)-1,1-dibromo-3,5,7-trimethyl-6-tri(propan-2-yl)silyloxynon-1-en-4-one |
|---|---|
| PubChem CID | 11156519 |
| Molecular Formula | C21H40Br2O2Si |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | (3R,5S,6R,7S)-1,1-dibromo-3,5,7-trimethyl-6-tri(propan-2-yl)silyloxynon-1-en-4-one |
| SMILES | CC[C@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C(=O)[C@H](C)C=C(Br)Br |
| InChI | InChI=1S/C21H40Br2O2Si/c1-11-16(8)21(18(10)20(24)17(9)12-19(22)23)25-26(13(2)3,14(4)5)15(6)7/h12-18,21H,11H2,1-10H3/t16-,17+,18+,21+/m0/s1 |
| InChIKey | NCQOBWONUQPWQC-XKGFGPFHSA-N |
| XLogP | 8.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|