C21H40O2Si — CID 11302621
(7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-propan-2-yldodeca-1,11-dien-5-one (PubChem CID 11302621) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-propan-2-yldodeca-1,11-dien-5-one.
| Compound Name | (7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-propan-2-yldodeca-1,11-dien-5-one |
|---|---|
| PubChem CID | 11302621 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-propan-2-yldodeca-1,11-dien-5-one |
| SMILES | C=CCCC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CCC=C)C(C)C |
| InChI | InChI=1S/C21H40O2Si/c1-10-12-14-18(22)16-20(19(17(3)4)15-13-11-2)23-24(8,9)21(5,6)7/h10-11,17,19-20H,1-2,12-16H2,3-9H3/t19-,20+/m1/s1 |
| InChIKey | WPUBVZCLXUMARE-UXHICEINSA-N |
| XLogP | 6.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|