C35H37FN+ — CID 138970804
3,6-ditert-butyl-9-(4-fluoro-2,6-dimethylphenyl)-10-phenylacridin-10-ium (PubChem CID 138970804) has the molecular formula C35H37FN+ and a molecular weight of 490.69 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-(4-fluoro-2,6-dimethylphenyl)-10-phenylacridin-10-ium.
| Compound Name | 3,6-ditert-butyl-9-(4-fluoro-2,6-dimethylphenyl)-10-phenylacridin-10-ium |
|---|---|
| PubChem CID | 138970804 |
| Molecular Formula | C35H37FN+ |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 3,6-ditert-butyl-9-(4-fluoro-2,6-dimethylphenyl)-10-phenylacridin-10-ium |
| SMILES | Cc1cc(F)cc(C)c1-c1c2ccc(C(C)(C)C)cc2[n+](-c2ccccc2)c2cc(C(C)(C)C)ccc12 |
| InChI | InChI=1S/C35H37FN/c1-22-18-26(36)19-23(2)32(22)33-28-16-14-24(34(3,4)5)20-30(28)37(27-12-10-9-11-13-27)31-21-25(35(6,7)8)15-17-29(31)33/h9-21H,1-8H3/q+1 |
| InChIKey | WVRYCJSDJPRHBB-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|