C7H9NO — CID 138971116
(2Z,4E)-6-hydroxy-3-methylhexa-2,4-dienenitrile (PubChem CID 138971116) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is (2Z,4E)-6-hydroxy-3-methylhexa-2,4-dienenitrile.
| Compound Name | (2Z,4E)-6-hydroxy-3-methylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 138971116 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (2Z,4E)-6-hydroxy-3-methylhexa-2,4-dienenitrile |
| SMILES | CC(=C/C#N)/C=C/CO |
| InChI | InChI=1S/C7H9NO/c1-7(4-5-8)3-2-6-9/h2-4,9H,6H2,1H3/b3-2+,7-4- |
| InChIKey | YSIJULHBROSQGE-SWBALALESA-N |
| XLogP | 1.00 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|