C7H9NO — CID 11007888
(2R,3E,5E)-2-hydroxyhepta-3,5-dienenitrile (PubChem CID 11007888) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is (2R,3E,5E)-2-hydroxyhepta-3,5-dienenitrile.
| Compound Name | (2R,3E,5E)-2-hydroxyhepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 11007888 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (2R,3E,5E)-2-hydroxyhepta-3,5-dienenitrile |
| SMILES | C/C=C/C=C/[C@@H](O)C#N |
| InChI | InChI=1S/C7H9NO/c1-2-3-4-5-7(9)6-8/h2-5,7,9H,1H3/b3-2+,5-4+/t7-/m1/s1 |
| InChIKey | KKZBEJYQUGERIB-XOCXLOGJSA-N |
| XLogP | 1.00 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|