C23H28FNO3 — CID 138971344
methyl 7-[(4-fluorobenzoyl)amino]-4,4-dimethyl-2-phenylheptanoate (PubChem CID 138971344) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is methyl 7-[(4-fluorobenzoyl)amino]-4,4-dimethyl-2-phenylheptanoate.
| Compound Name | methyl 7-[(4-fluorobenzoyl)amino]-4,4-dimethyl-2-phenylheptanoate |
|---|---|
| PubChem CID | 138971344 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | methyl 7-[(4-fluorobenzoyl)amino]-4,4-dimethyl-2-phenylheptanoate |
| SMILES | COC(=O)C(CC(C)(C)CCCNC(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H28FNO3/c1-23(2,16-20(22(27)28-3)17-8-5-4-6-9-17)14-7-15-25-21(26)18-10-12-19(24)13-11-18/h4-6,8-13,20H,7,14-16H2,1-3H3,(H,25,26) |
| InChIKey | NWANYQLWFPDMFY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|