C23H24FNO3 — CID 135304513
(E)-3-[3-[2-(4-fluorophenyl)ethylcarbamoyl]-5-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid (PubChem CID 135304513) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is (E)-3-[3-[2-(4-fluorophenyl)ethylcarbamoyl]-5-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-(4-fluorophenyl)ethylcarbamoyl]-5-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 135304513 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (E)-3-[3-[2-(4-fluorophenyl)ethylcarbamoyl]-5-(3-methylbut-2-enyl)phenyl]prop-2-enoic acid |
| SMILES | CC(C)=CCc1cc(/C=C/C(=O)O)cc(C(=O)NCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H24FNO3/c1-16(2)3-4-18-13-19(7-10-22(26)27)15-20(14-18)23(28)25-12-11-17-5-8-21(24)9-6-17/h3,5-10,13-15H,4,11-12H2,1-2H3,(H,25,28)(H,26,27)/b10-7+ |
| InChIKey | LYPFVLPMHOEBJY-JXMROGBWSA-N |
| XLogP | 4.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|