C19H14N2O7 — CID 138971543
ethyl (1R)-1-[(1R)-5-nitro-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 138971543) has the molecular formula C19H14N2O7 and a molecular weight of 382.33 g/mol. Its IUPAC name is ethyl (1R)-1-[(1R)-5-nitro-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | ethyl (1R)-1-[(1R)-5-nitro-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 138971543 |
| Molecular Formula | C19H14N2O7 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | ethyl (1R)-1-[(1R)-5-nitro-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1([C@@H]2OC(=O)c3cc([N+](=O)[O-])ccc32)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C19H14N2O7/c1-2-27-18(24)19(14-6-4-3-5-12(14)16(22)20-19)15-11-8-7-10(21(25)26)9-13(11)17(23)28-15/h3-9,15H,2H2,1H3,(H,20,22)/t15-,19-/m1/s1 |
| InChIKey | RNPSJWHAFWSPEY-DNVCBOLYSA-N |
| XLogP | 2.01 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|