C22H23N3O7 — CID 10741815
methyl (2S)-2-(6-nitro-3-oxo-1H-isoindol-2-yl)-5-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 10741815) has the molecular formula C22H23N3O7 and a molecular weight of 441.44 g/mol. Its IUPAC name is methyl (2S)-2-(6-nitro-3-oxo-1H-isoindol-2-yl)-5-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | methyl (2S)-2-(6-nitro-3-oxo-1H-isoindol-2-yl)-5-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 10741815 |
| Molecular Formula | C22H23N3O7 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | methyl (2S)-2-(6-nitro-3-oxo-1H-isoindol-2-yl)-5-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | COC(=O)[C@H](CCCNC(=O)OCc1ccccc1)N1Cc2cc([N+](=O)[O-])ccc2C1=O |
| InChI | InChI=1S/C22H23N3O7/c1-31-21(27)19(8-5-11-23-22(28)32-14-15-6-3-2-4-7-15)24-13-16-12-17(25(29)30)9-10-18(16)20(24)26/h2-4,6-7,9-10,12,19H,5,8,11,13-14H2,1H3,(H,23,28)/t19-/m0/s1 |
| InChIKey | NQVPDCZCTYLTJH-IBGZPJMESA-N |
| XLogP | 2.80 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|