C10H13NO — CID 138972478
1-[(1R,6S)-9-azatricyclo[4.3.0.02,9]non-3-en-1-yl]ethanone (PubChem CID 138972478) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-[(1R,6S)-9-azatricyclo[4.3.0.02,9]non-3-en-1-yl]ethanone.
| Compound Name | 1-[(1R,6S)-9-azatricyclo[4.3.0.02,9]non-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 138972478 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-[(1R,6S)-9-azatricyclo[4.3.0.02,9]non-3-en-1-yl]ethanone |
| SMILES | CC(=O)[C@]12C3C=CC[C@H]1CCN32 |
| InChI | InChI=1S/C10H13NO/c1-7(12)10-8-3-2-4-9(10)11(10)6-5-8/h2,4,8-9H,3,5-6H2,1H3/t8-,9?,10+,11?/m0/s1 |
| InChIKey | GDDBREQWFQOARU-QPBDYMMBSA-N |
| XLogP | 0.98 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|