C15H25N2O+ — CID 101423117
1-[(2R,3R)-3-ethenyl-1-methylpyrrolidin-2-yl]-2-(1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl)ethanone (PubChem CID 101423117) has the molecular formula C15H25N2O+ and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-[(2R,3R)-3-ethenyl-1-methylpyrrolidin-2-yl]-2-(1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-[(2R,3R)-3-ethenyl-1-methylpyrrolidin-2-yl]-2-(1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 101423117 |
| Molecular Formula | C15H25N2O+ |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.20 |
| IUPAC Name | 1-[(2R,3R)-3-ethenyl-1-methylpyrrolidin-2-yl]-2-(1-methyl-3,6-dihydro-2H-pyridin-1-ium-1-yl)ethanone |
| SMILES | C=C[C@H]1CCN(C)[C@H]1C(=O)C[N+]1(C)CC=CCC1 |
| InChI | InChI=1S/C15H25N2O/c1-4-13-8-9-16(2)15(13)14(18)12-17(3)10-6-5-7-11-17/h4-6,13,15H,1,7-12H2,2-3H3/q+1/t13-,15+,17?/m0/s1 |
| InChIKey | NKDREQMWERGZTO-GZJFXKPMSA-N |
| XLogP | 1.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|