C10H17NO — CID 59911310
1-[(2R,4R,5S)-5-ethenyl-1,4-dimethylpyrrolidin-2-yl]ethanone (PubChem CID 59911310) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-[(2R,4R,5S)-5-ethenyl-1,4-dimethylpyrrolidin-2-yl]ethanone.
| Compound Name | 1-[(2R,4R,5S)-5-ethenyl-1,4-dimethylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 59911310 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-[(2R,4R,5S)-5-ethenyl-1,4-dimethylpyrrolidin-2-yl]ethanone |
| SMILES | C=C[C@H]1[C@H](C)C[C@H](C(C)=O)N1C |
| InChI | InChI=1S/C10H17NO/c1-5-9-7(2)6-10(8(3)12)11(9)4/h5,7,9-10H,1,6H2,2-4H3/t7-,9+,10-/m1/s1 |
| InChIKey | DAJAADIBNBHILV-FKTZTGRPSA-N |
| XLogP | 1.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|