C11H19NO — CID 59911038
1-[(2R,4R,5S)-5-ethenyl-4-ethyl-1-methylpyrrolidin-2-yl]ethanone (PubChem CID 59911038) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-[(2R,4R,5S)-5-ethenyl-4-ethyl-1-methylpyrrolidin-2-yl]ethanone.
| Compound Name | 1-[(2R,4R,5S)-5-ethenyl-4-ethyl-1-methylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 59911038 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 1-[(2R,4R,5S)-5-ethenyl-4-ethyl-1-methylpyrrolidin-2-yl]ethanone |
| SMILES | C=C[C@H]1[C@H](CC)C[C@H](C(C)=O)N1C |
| InChI | InChI=1S/C11H19NO/c1-5-9-7-11(8(3)13)12(4)10(9)6-2/h6,9-11H,2,5,7H2,1,3-4H3/t9-,10+,11-/m1/s1 |
| InChIKey | KTHWXSBTYBRORW-OUAUKWLOSA-N |
| XLogP | 1.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|