C20H24F2O3 — CID 138972616
7-hydroxyheptyl 3,3-difluoro-2-naphthalen-2-ylpropanoate (PubChem CID 138972616) has the molecular formula C20H24F2O3 and a molecular weight of 350.40 g/mol. Its IUPAC name is 7-hydroxyheptyl 3,3-difluoro-2-naphthalen-2-ylpropanoate.
| Compound Name | 7-hydroxyheptyl 3,3-difluoro-2-naphthalen-2-ylpropanoate |
|---|---|
| PubChem CID | 138972616 |
| Molecular Formula | C20H24F2O3 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 7-hydroxyheptyl 3,3-difluoro-2-naphthalen-2-ylpropanoate |
| SMILES | O=C(OCCCCCCCO)C(c1ccc2ccccc2c1)C(F)F |
| InChI | InChI=1S/C20H24F2O3/c21-19(22)18(20(24)25-13-7-3-1-2-6-12-23)17-11-10-15-8-4-5-9-16(15)14-17/h4-5,8-11,14,18-19,23H,1-3,6-7,12-13H2 |
| InChIKey | VOCYFXQZTRELQP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|