C17H23NO3 — CID 138973080
4-[4-[2-(1,3-dioxolan-2-ylmethyl)cyclopropyl]phenyl]morpholine (PubChem CID 138973080) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[4-[2-(1,3-dioxolan-2-ylmethyl)cyclopropyl]phenyl]morpholine.
| Compound Name | 4-[4-[2-(1,3-dioxolan-2-ylmethyl)cyclopropyl]phenyl]morpholine |
|---|---|
| PubChem CID | 138973080 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 4-[4-[2-(1,3-dioxolan-2-ylmethyl)cyclopropyl]phenyl]morpholine |
| SMILES | c1cc(N2CCOCC2)ccc1C1CC1CC1OCCO1 |
| InChI | InChI=1S/C17H23NO3/c1-3-15(18-5-7-19-8-6-18)4-2-13(1)16-11-14(16)12-17-20-9-10-21-17/h1-4,14,16-17H,5-12H2 |
| InChIKey | BPIRMZZMBMXMTD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|