C14H18N2O3 — CID 25266081
[5-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazol-3-yl]methanol (PubChem CID 25266081) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is [5-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazol-3-yl]methanol.
| Compound Name | [5-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazol-3-yl]methanol |
|---|---|
| PubChem CID | 25266081 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | [5-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,2-oxazol-3-yl]methanol |
| SMILES | OCC1=NOC(c2ccc(N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C14H18N2O3/c17-10-12-9-14(19-15-12)11-1-3-13(4-2-11)16-5-7-18-8-6-16/h1-4,14,17H,5-10H2 |
| InChIKey | NOTXCDRYNOSBOQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|