C19H14ClNO5 — CID 138973209
ethyl (1R)-1-[(1R)-5-chloro-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 138973209) has the molecular formula C19H14ClNO5 and a molecular weight of 371.78 g/mol. Its IUPAC name is ethyl (1R)-1-[(1R)-5-chloro-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | ethyl (1R)-1-[(1R)-5-chloro-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 138973209 |
| Molecular Formula | C19H14ClNO5 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | ethyl (1R)-1-[(1R)-5-chloro-3-oxo-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1([C@@H]2OC(=O)c3cc(Cl)ccc32)NC(=O)c2ccccc21 |
| InChI | InChI=1S/C19H14ClNO5/c1-2-25-18(24)19(14-6-4-3-5-12(14)16(22)21-19)15-11-8-7-10(20)9-13(11)17(23)26-15/h3-9,15H,2H2,1H3,(H,21,22)/t15-,19-/m1/s1 |
| InChIKey | JCSPBFRMBJCZOX-DNVCBOLYSA-N |
| XLogP | 2.75 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |