C19H15FN2O4 — CID 138971661
ethyl (1R)-1-[(1R)-5-fluoro-3-imino-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 138971661) has the molecular formula C19H15FN2O4 and a molecular weight of 354.34 g/mol. Its IUPAC name is ethyl (1R)-1-[(1R)-5-fluoro-3-imino-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | ethyl (1R)-1-[(1R)-5-fluoro-3-imino-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 138971661 |
| Molecular Formula | C19H15FN2O4 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | ethyl (1R)-1-[(1R)-5-fluoro-3-imino-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | [H]/N=C1\O[C@@H]([C@]2(C(=O)OCC)NC(=O)c3ccccc32)c2ccc(F)cc21 |
| InChI | InChI=1S/C19H15FN2O4/c1-2-25-18(24)19(14-6-4-3-5-12(14)17(23)22-19)15-11-8-7-10(20)9-13(11)16(21)26-15/h3-9,15,21H,2H2,1H3,(H,22,23)/b21-16-/t15-,19-/m1/s1 |
| InChIKey | NWOUNRUGKLRWEY-MDCHLKGISA-N |
| XLogP | 2.42 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|