C29H22N2O4 — CID 138972585
ethyl (1R)-1-[(1R)-3-imino-5-naphthalen-1-yl-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 138972585) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is ethyl (1R)-1-[(1R)-3-imino-5-naphthalen-1-yl-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | ethyl (1R)-1-[(1R)-3-imino-5-naphthalen-1-yl-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 138972585 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | ethyl (1R)-1-[(1R)-3-imino-5-naphthalen-1-yl-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | [H]/N=C1\O[C@@H]([C@]2(C(=O)OCC)NC(=O)c3ccccc32)c2ccc(-c3cccc4ccccc34)cc21 |
| InChI | InChI=1S/C29H22N2O4/c1-2-34-28(33)29(24-13-6-5-11-22(24)27(32)31-29)25-21-15-14-18(16-23(21)26(30)35-25)20-12-7-9-17-8-3-4-10-19(17)20/h3-16,25,30H,2H2,1H3,(H,31,32)/b30-26-/t25-,29-/m1/s1 |
| InChIKey | UGAWMCAIXPZHHB-UYLTVHLASA-N |
| XLogP | 5.11 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|