C28H26N2O6 — CID 46608182
[2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate (PubChem CID 46608182) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate.
| Compound Name | [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 46608182 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | [2-(1-naphthalen-1-ylethylamino)-2-oxoethyl] 1,3-dioxo-2-(oxolan-2-ylmethyl)isoindole-5-carboxylate |
| SMILES | CC(NC(=O)COC(=O)c1ccc2c(c1)C(=O)N(CC1CCCO1)C2=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H26N2O6/c1-17(21-10-4-7-18-6-2-3-9-22(18)21)29-25(31)16-36-28(34)19-11-12-23-24(14-19)27(33)30(26(23)32)15-20-8-5-13-35-20/h2-4,6-7,9-12,14,17,20H,5,8,13,15-16H2,1H3,(H,29,31) |
| InChIKey | CFBAWKOFFLMWJJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|