C25H20N2O4 — CID 138971544
ethyl (1R)-1-[(1R)-3-imino-5-phenyl-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate (PubChem CID 138971544) has the molecular formula C25H20N2O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is ethyl (1R)-1-[(1R)-3-imino-5-phenyl-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate.
| Compound Name | ethyl (1R)-1-[(1R)-3-imino-5-phenyl-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 138971544 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | ethyl (1R)-1-[(1R)-3-imino-5-phenyl-1H-2-benzofuran-1-yl]-3-oxo-2H-isoindole-1-carboxylate |
| SMILES | [H]/N=C1\O[C@@H]([C@]2(C(=O)OCC)NC(=O)c3ccccc32)c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C25H20N2O4/c1-2-30-24(29)25(20-11-7-6-10-18(20)23(28)27-25)21-17-13-12-16(14-19(17)22(26)31-21)15-8-4-3-5-9-15/h3-14,21,26H,2H2,1H3,(H,27,28)/b26-22-/t21-,25-/m1/s1 |
| InChIKey | PQOXAEASVKQWNG-MKZPYABQSA-N |
| XLogP | 3.95 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|