C20H18BrNO2 — CID 138973539
benzyl 2-[2-(4-bromophenyl)ethynyl]pyrrolidine-1-carboxylate (PubChem CID 138973539) has the molecular formula C20H18BrNO2 and a molecular weight of 384.27 g/mol. Its IUPAC name is benzyl 2-[2-(4-bromophenyl)ethynyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[2-(4-bromophenyl)ethynyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 138973539 |
| Molecular Formula | C20H18BrNO2 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | benzyl 2-[2-(4-bromophenyl)ethynyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC1C#Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H18BrNO2/c21-18-11-8-16(9-12-18)10-13-19-7-4-14-22(19)20(23)24-15-17-5-2-1-3-6-17/h1-3,5-6,8-9,11-12,19H,4,7,14-15H2 |
| InChIKey | FHILWRXQSUZKGM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|