C20H17BrF3NO2 — CID 145453128
benzyl (2R,3S)-2-(2-bromophenyl)-4-methylidene-3-(trifluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 145453128) has the molecular formula C20H17BrF3NO2 and a molecular weight of 440.26 g/mol. Its IUPAC name is benzyl (2R,3S)-2-(2-bromophenyl)-4-methylidene-3-(trifluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-2-(2-bromophenyl)-4-methylidene-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145453128 |
| Molecular Formula | C20H17BrF3NO2 |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | benzyl (2R,3S)-2-(2-bromophenyl)-4-methylidene-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | C=C1CN(C(=O)OCc2ccccc2)[C@@H](c2ccccc2Br)[C@H]1C(F)(F)F |
| InChI | InChI=1S/C20H17BrF3NO2/c1-13-11-25(19(26)27-12-14-7-3-2-4-8-14)18(17(13)20(22,23)24)15-9-5-6-10-16(15)21/h2-10,17-18H,1,11-12H2/t17-,18-/m0/s1 |
| InChIKey | OWTUEFLAOLSJPG-ROUUACIJSA-N |
| XLogP | 5.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|