C27H20F7NO2 — CID 145453083
benzyl (2R,3S)-3-[3,5-bis(trifluoromethyl)phenyl]-2-(4-fluorophenyl)-4-methylidenepyrrolidine-1-carboxylate (PubChem CID 145453083) has the molecular formula C27H20F7NO2 and a molecular weight of 523.45 g/mol. Its IUPAC name is benzyl (2R,3S)-3-[3,5-bis(trifluoromethyl)phenyl]-2-(4-fluorophenyl)-4-methylidenepyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-3-[3,5-bis(trifluoromethyl)phenyl]-2-(4-fluorophenyl)-4-methylidenepyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145453083 |
| Molecular Formula | C27H20F7NO2 |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | benzyl (2R,3S)-3-[3,5-bis(trifluoromethyl)phenyl]-2-(4-fluorophenyl)-4-methylidenepyrrolidine-1-carboxylate |
| SMILES | C=C1CN(C(=O)OCc2ccccc2)[C@@H](c2ccc(F)cc2)[C@H]1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H20F7NO2/c1-16-14-35(25(36)37-15-17-5-3-2-4-6-17)24(18-7-9-22(28)10-8-18)23(16)19-11-20(26(29,30)31)13-21(12-19)27(32,33)34/h2-13,23-24H,1,14-15H2/t23-,24+/m1/s1 |
| InChIKey | GHDCDEIPHGRUCC-RPWUZVMVSA-N |
| XLogP | 7.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|