C21H20F3NO2 — CID 145453108
benzyl (2R,3S)-4-methylidene-2-(3-methylphenyl)-3-(trifluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 145453108) has the molecular formula C21H20F3NO2 and a molecular weight of 375.39 g/mol. Its IUPAC name is benzyl (2R,3S)-4-methylidene-2-(3-methylphenyl)-3-(trifluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R,3S)-4-methylidene-2-(3-methylphenyl)-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145453108 |
| Molecular Formula | C21H20F3NO2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | benzyl (2R,3S)-4-methylidene-2-(3-methylphenyl)-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | C=C1CN(C(=O)OCc2ccccc2)[C@@H](c2cccc(C)c2)[C@H]1C(F)(F)F |
| InChI | InChI=1S/C21H20F3NO2/c1-14-7-6-10-17(11-14)19-18(21(22,23)24)15(2)12-25(19)20(26)27-13-16-8-4-3-5-9-16/h3-11,18-19H,2,12-13H2,1H3/t18-,19-/m0/s1 |
| InChIKey | CLJXRTIFKKJXGW-OALUTQOASA-N |
| XLogP | 5.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|