C14H12F3NO3 — CID 138973631
ethyl 3-methyl-1-oxo-6-(trifluoromethyl)-2H-isoquinoline-4-carboxylate (PubChem CID 138973631) has the molecular formula C14H12F3NO3 and a molecular weight of 299.25 g/mol. Its IUPAC name is ethyl 3-methyl-1-oxo-6-(trifluoromethyl)-2H-isoquinoline-4-carboxylate.
| Compound Name | ethyl 3-methyl-1-oxo-6-(trifluoromethyl)-2H-isoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 138973631 |
| Molecular Formula | C14H12F3NO3 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | ethyl 3-methyl-1-oxo-6-(trifluoromethyl)-2H-isoquinoline-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(=O)c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C14H12F3NO3/c1-3-21-13(20)11-7(2)18-12(19)9-5-4-8(6-10(9)11)14(15,16)17/h4-6H,3H2,1-2H3,(H,18,19) |
| InChIKey | OYOKSLSBBZKMMM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |