C24H20F6O2 — CID 138973751
[(1R,4aR,8aR)-3-[4-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-isochromen-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 138973751) has the molecular formula C24H20F6O2 and a molecular weight of 454.41 g/mol. Its IUPAC name is [(1R,4aR,8aR)-3-[4-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-isochromen-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(1R,4aR,8aR)-3-[4-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-isochromen-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 138973751 |
| Molecular Formula | C24H20F6O2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [(1R,4aR,8aR)-3-[4-(trifluoromethyl)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-isochromen-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)[C@@H]1OC(c2ccc(C(F)(F)F)cc2)=C[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C24H20F6O2/c25-23(26,27)17-9-5-14(6-10-17)20-13-16-3-1-2-4-19(16)22(32-20)21(31)15-7-11-18(12-8-15)24(28,29)30/h5-13,16,19,22H,1-4H2/t16-,19+,22+/m0/s1 |
| InChIKey | TZQOZYMKEZUXFW-DKZVUGQWSA-N |
| XLogP | 7.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |