C10H14FN7O2 — CID 138974069
(4R,5R)-4-azido-5-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepane (PubChem CID 138974069) has the molecular formula C10H14FN7O2 and a molecular weight of 283.27 g/mol. Its IUPAC name is (4R,5R)-4-azido-5-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepane.
| Compound Name | (4R,5R)-4-azido-5-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepane |
|---|---|
| PubChem CID | 138974069 |
| Molecular Formula | C10H14FN7O2 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (4R,5R)-4-azido-5-fluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepane |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CC[C@@H](F)[C@H](N=[N+]=[N-])CC1 |
| InChI | InChI=1S/C10H14FN7O2/c1-16-10(9(6-13-16)18(19)20)17-4-2-7(11)8(3-5-17)14-15-12/h6-8H,2-5H2,1H3/t7-,8-/m1/s1 |
| InChIKey | VCHIJQBSOBWVBC-HTQZYQBOSA-N |
| XLogP | 1.95 |
| TPSA | 112.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|