C13H18F3N5O3 — CID 86658409
N-[1-(1-ethyl-4-nitropyrazol-5-yl)azepan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 86658409) has the molecular formula C13H18F3N5O3 and a molecular weight of 349.31 g/mol. Its IUPAC name is N-[1-(1-ethyl-4-nitropyrazol-5-yl)azepan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-(1-ethyl-4-nitropyrazol-5-yl)azepan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 86658409 |
| Molecular Formula | C13H18F3N5O3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-[1-(1-ethyl-4-nitropyrazol-5-yl)azepan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | CCn1ncc([N+](=O)[O-])c1N1CCCC(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H18F3N5O3/c1-2-20-11(10(8-17-20)21(23)24)19-6-3-4-9(5-7-19)18-12(22)13(14,15)16/h8-9H,2-7H2,1H3,(H,18,22) |
| InChIKey | AQUMPXSAQYKJOK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|