C15H23F2N5O4 — CID 86679991
tert-butyl N-[6,6-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate (PubChem CID 86679991) has the molecular formula C15H23F2N5O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is tert-butyl N-[6,6-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate.
| Compound Name | tert-butyl N-[6,6-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate |
|---|---|
| PubChem CID | 86679991 |
| Molecular Formula | C15H23F2N5O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | tert-butyl N-[6,6-difluoro-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]carbamate |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCC(NC(=O)OC(C)(C)C)CC(F)(F)C1 |
| InChI | InChI=1S/C15H23F2N5O4/c1-14(2,3)26-13(23)19-10-5-6-21(9-15(16,17)7-10)12-11(22(24)25)8-18-20(12)4/h8,10H,5-7,9H2,1-4H3,(H,19,23) |
| InChIKey | OIQGDXURGUFLKR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|